C8H13Cl2NO2 — CID 79173074
2-[2,3-dichloroprop-2-enyl(methyl)amino]butanoic acid (PubChem CID 79173074) has the molecular formula C8H13Cl2NO2 and a molecular weight of 226.10 g/mol. Its IUPAC name is 2-[2,3-dichloroprop-2-enyl(methyl)amino]butanoic acid.
| Compound Name | 2-[2,3-dichloroprop-2-enyl(methyl)amino]butanoic acid |
|---|---|
| PubChem CID | 79173074 |
| Molecular Formula | C8H13Cl2NO2 |
| Molecular Weight | 226.10 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 2-[2,3-dichloroprop-2-enyl(methyl)amino]butanoic acid |
| SMILES | CCC(C(=O)O)N(C)CC(Cl)=CCl |
| InChI | InChI=1S/C8H13Cl2NO2/c1-3-7(8(12)13)11(2)5-6(10)4-9/h4,7H,3,5H2,1-2H3,(H,12,13) |
| InChIKey | ZPVOUTSEFYDNTC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.10 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |