C7H13Cl2NS — CID 79173763
3-(2,3-dichloroprop-2-enylsulfanyl)butan-1-amine (PubChem CID 79173763) has the molecular formula C7H13Cl2NS and a molecular weight of 214.16 g/mol. Its IUPAC name is 3-(2,3-dichloroprop-2-enylsulfanyl)butan-1-amine.
| Compound Name | 3-(2,3-dichloroprop-2-enylsulfanyl)butan-1-amine |
|---|---|
| PubChem CID | 79173763 |
| Molecular Formula | C7H13Cl2NS |
| Molecular Weight | 214.16 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | 3-(2,3-dichloroprop-2-enylsulfanyl)butan-1-amine |
| SMILES | CC(CCN)SCC(Cl)=CCl |
| InChI | InChI=1S/C7H13Cl2NS/c1-6(2-3-10)11-5-7(9)4-8/h4,6H,2-3,5,10H2,1H3 |
| InChIKey | SBQYWOPWROOSSS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.16 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |