C6H11Cl2NS — CID 79173660
1-(2,3-dichloroprop-2-enylsulfanyl)propan-2-amine (PubChem CID 79173660) has the molecular formula C6H11Cl2NS and a molecular weight of 200.13 g/mol. Its IUPAC name is 1-(2,3-dichloroprop-2-enylsulfanyl)propan-2-amine.
| Compound Name | 1-(2,3-dichloroprop-2-enylsulfanyl)propan-2-amine |
|---|---|
| PubChem CID | 79173660 |
| Molecular Formula | C6H11Cl2NS |
| Molecular Weight | 200.13 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 1-(2,3-dichloroprop-2-enylsulfanyl)propan-2-amine |
| SMILES | CC(N)CSCC(Cl)=CCl |
| InChI | InChI=1S/C6H11Cl2NS/c1-5(9)3-10-4-6(8)2-7/h2,5H,3-4,9H2,1H3 |
| InChIKey | POQJKMNKLRFCAN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.13 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |