3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid

C7H11Cl2NO2 — CID 79173884

IUPAC3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid
SMILESCN(CCC(=O)O)CC(Cl)=CCl
InChIInChI=1S/C7H11Cl2NO2/c1-10(3-2-7(11)12)5-6(9)4-8/h4H,2-3,5H2,1H3,(H,11,12)
InChIKeyOKWJJHKBUVXFMO-UHFFFAOYSA-N
MW212.08 g/mol
LogP1.71
Rot. Bonds5

About 3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid

3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid (PubChem CID 79173884) has the molecular formula C7H11Cl2NO2 and a molecular weight of 212.08 g/mol. Its IUPAC name is 3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid.

Molecular Properties

Compound Name3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid
PubChem CID79173884
Molecular FormulaC7H11Cl2NO2
Molecular Weight212.08 g/mol
Exact Mass211.02
IUPAC Name3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid
SMILESCN(CCC(=O)O)CC(Cl)=CCl
InChIInChI=1S/C7H11Cl2NO2/c1-10(3-2-7(11)12)5-6(9)4-8/h4H,2-3,5H2,1H3,(H,11,12)
InChIKeyOKWJJHKBUVXFMO-UHFFFAOYSA-N
XLogP1.71
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.08
LogP ≤ 51.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid?
The IUPAC name of 3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid (CID 79173884) is 3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid.
What is the SMILES notation for 3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid?
The canonical SMILES for 3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid is CN(CCC(=O)O)CC(Cl)=CCl.
What is the InChIKey of 3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid?
The InChIKey is OKWJJHKBUVXFMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11Cl2NO2/c1-10(3-2-7(11)12)5-6(9)4-8/h4H,2-3,5H2,1H3,(H,11,12).
What are the key properties of 3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid?
3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid has a molecular weight of 212.08 g/mol, XLogP of 1.71, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid is sourced from PubChem (CID 79173884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).