C7H11Cl2NO2 — CID 79173884
3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid (PubChem CID 79173884) has the molecular formula C7H11Cl2NO2 and a molecular weight of 212.08 g/mol. Its IUPAC name is 3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid.
| Compound Name | 3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid |
|---|---|
| PubChem CID | 79173884 |
| Molecular Formula | C7H11Cl2NO2 |
| Molecular Weight | 212.08 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 3-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid |
| SMILES | CN(CCC(=O)O)CC(Cl)=CCl |
| InChI | InChI=1S/C7H11Cl2NO2/c1-10(3-2-7(11)12)5-6(9)4-8/h4H,2-3,5H2,1H3,(H,11,12) |
| InChIKey | OKWJJHKBUVXFMO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.08 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |