C17H35N3 — CID 79175486
2-methyl-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)octan-1-amine (PubChem CID 79175486) has the molecular formula C17H35N3 and a molecular weight of 281.49 g/mol. Its IUPAC name is 2-methyl-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)octan-1-amine.
| Compound Name | 2-methyl-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)octan-1-amine |
|---|---|
| PubChem CID | 79175486 |
| Molecular Formula | C17H35N3 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.28 |
| IUPAC Name | 2-methyl-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)octan-1-amine |
| SMILES | CCCCCCC(C)(CN)N1CCC2CCC(C1)N2C |
| InChI | InChI=1S/C17H35N3/c1-4-5-6-7-11-17(2,14-18)20-12-10-15-8-9-16(13-20)19(15)3/h15-16H,4-14,18H2,1-3H3 |
| InChIKey | ULEGNGAYGSOLQD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|