C15H33N3 — CID 80557428
1-(1-amino-2-methylheptan-2-yl)-N,N-dimethylpiperidin-3-amine (PubChem CID 80557428) has the molecular formula C15H33N3 and a molecular weight of 255.45 g/mol. Its IUPAC name is 1-(1-amino-2-methylheptan-2-yl)-N,N-dimethylpiperidin-3-amine.
| Compound Name | 1-(1-amino-2-methylheptan-2-yl)-N,N-dimethylpiperidin-3-amine |
|---|---|
| PubChem CID | 80557428 |
| Molecular Formula | C15H33N3 |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.27 |
| IUPAC Name | 1-(1-amino-2-methylheptan-2-yl)-N,N-dimethylpiperidin-3-amine |
| SMILES | CCCCCC(C)(CN)N1CCCC(N(C)C)C1 |
| InChI | InChI=1S/C15H33N3/c1-5-6-7-10-15(2,13-16)18-11-8-9-14(12-18)17(3)4/h14H,5-13,16H2,1-4H3 |
| InChIKey | LXWIDEAWYPFBPA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|