About 3-(3,4-dimethylpyrrolidin-1-yl)-2-(ethylamino)propanamide
3-(3,4-dimethylpyrrolidin-1-yl)-2-(ethylamino)propanamide (PubChem CID 79183325) has the molecular formula C11H23N3O
and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-(3,4-dimethylpyrrolidin-1-yl)-2-(ethylamino)propanamide.
Molecular Properties
| Compound Name | 3-(3,4-dimethylpyrrolidin-1-yl)-2-(ethylamino)propanamide |
| PubChem CID | 79183325 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 3-(3,4-dimethylpyrrolidin-1-yl)-2-(ethylamino)propanamide |
| SMILES | CCNC(CN1CC(C)C(C)C1)C(N)=O |
| InChI | InChI=1S/C11H23N3O/c1-4-13-10(11(12)15)7-14-5-8(2)9(3)6-14/h8-10,13H,4-7H2,1-3H3,(H2,12,15) |
| InChIKey | LCXFRZUQACXNAO-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,4-dimethylpyrrolidin-1-yl)-2-(ethylamino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethylpyrrolidin-1-yl)-2-(ethylamino)propanamide?
The IUPAC name of 3-(3,4-dimethylpyrrolidin-1-yl)-2-(ethylamino)propanamide (CID 79183325) is 3-(3,4-dimethylpyrrolidin-1-yl)-2-(ethylamino)propanamide.
What is the SMILES notation for 3-(3,4-dimethylpyrrolidin-1-yl)-2-(ethylamino)propanamide?
The canonical SMILES for 3-(3,4-dimethylpyrrolidin-1-yl)-2-(ethylamino)propanamide is CCNC(CN1CC(C)C(C)C1)C(N)=O.
What is the InChIKey of 3-(3,4-dimethylpyrrolidin-1-yl)-2-(ethylamino)propanamide?
The InChIKey is LCXFRZUQACXNAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O/c1-4-13-10(11(12)15)7-14-5-8(2)9(3)6-14/h8-10,13H,4-7H2,1-3H3,(H2,12,15).
What are the key properties of 3-(3,4-dimethylpyrrolidin-1-yl)-2-(ethylamino)propanamide?
3-(3,4-dimethylpyrrolidin-1-yl)-2-(ethylamino)propanamide has a molecular weight of 213.32 g/mol, XLogP of 0.04, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethylpyrrolidin-1-yl)-2-(ethylamino)propanamide is sourced from PubChem (CID 79183325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).