C14H28N2 — CID 79184231
N-[5-(3,4-dimethylpyrrolidin-1-yl)pentyl]cyclopropanamine (PubChem CID 79184231) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is N-[5-(3,4-dimethylpyrrolidin-1-yl)pentyl]cyclopropanamine.
| Compound Name | N-[5-(3,4-dimethylpyrrolidin-1-yl)pentyl]cyclopropanamine |
|---|---|
| PubChem CID | 79184231 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | N-[5-(3,4-dimethylpyrrolidin-1-yl)pentyl]cyclopropanamine |
| SMILES | CC1CN(CCCCCNC2CC2)CC1C |
| InChI | InChI=1S/C14H28N2/c1-12-10-16(11-13(12)2)9-5-3-4-8-15-14-6-7-14/h12-15H,3-11H2,1-2H3 |
| InChIKey | YZKSDWAGALZIDG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|