C18H35N — CID 79185086
1-(4-tert-butylcyclohexyl)-3-methyl-N-propylbut-3-en-1-amine (PubChem CID 79185086) has the molecular formula C18H35N and a molecular weight of 265.48 g/mol. Its IUPAC name is 1-(4-tert-butylcyclohexyl)-3-methyl-N-propylbut-3-en-1-amine.
| Compound Name | 1-(4-tert-butylcyclohexyl)-3-methyl-N-propylbut-3-en-1-amine |
|---|---|
| PubChem CID | 79185086 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | 1-(4-tert-butylcyclohexyl)-3-methyl-N-propylbut-3-en-1-amine |
| SMILES | C=C(C)CC(NCCC)C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H35N/c1-7-12-19-17(13-14(2)3)15-8-10-16(11-9-15)18(4,5)6/h15-17,19H,2,7-13H2,1,3-6H3 |
| InChIKey | XPAASRJGTSDUKZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|