C18H36N2O — CID 114466187
1-(4-tert-butylcyclohexyl)-N-[2-(2-methylprop-2-enoxy)ethyl]ethane-1,2-diamine (PubChem CID 114466187) has the molecular formula C18H36N2O and a molecular weight of 296.50 g/mol. Its IUPAC name is 1-(4-tert-butylcyclohexyl)-N-[2-(2-methylprop-2-enoxy)ethyl]ethane-1,2-diamine.
| Compound Name | 1-(4-tert-butylcyclohexyl)-N-[2-(2-methylprop-2-enoxy)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 114466187 |
| Molecular Formula | C18H36N2O |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.28 |
| IUPAC Name | 1-(4-tert-butylcyclohexyl)-N-[2-(2-methylprop-2-enoxy)ethyl]ethane-1,2-diamine |
| SMILES | C=C(C)COCCNC(CN)C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H36N2O/c1-14(2)13-21-11-10-20-17(12-19)15-6-8-16(9-7-15)18(3,4)5/h15-17,20H,1,6-13,19H2,2-5H3 |
| InChIKey | WSRACCTWFTXNDB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|