C16H33N3O — CID 104575469
1-(4-tert-butylcyclohexyl)-N-morpholin-4-ylethane-1,2-diamine (PubChem CID 104575469) has the molecular formula C16H33N3O and a molecular weight of 283.46 g/mol. Its IUPAC name is 1-(4-tert-butylcyclohexyl)-N-morpholin-4-ylethane-1,2-diamine.
| Compound Name | 1-(4-tert-butylcyclohexyl)-N-morpholin-4-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 104575469 |
| Molecular Formula | C16H33N3O |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.26 |
| IUPAC Name | 1-(4-tert-butylcyclohexyl)-N-morpholin-4-ylethane-1,2-diamine |
| SMILES | CC(C)(C)C1CCC(C(CN)NN2CCOCC2)CC1 |
| InChI | InChI=1S/C16H33N3O/c1-16(2,3)14-6-4-13(5-7-14)15(12-17)18-19-8-10-20-11-9-19/h13-15,18H,4-12,17H2,1-3H3 |
| InChIKey | FLDQDSUTBPZIRZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |