C13H27N3 — CID 83011945
1-cyclohexyl-N-piperidin-1-ylethane-1,2-diamine (PubChem CID 83011945) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is 1-cyclohexyl-N-piperidin-1-ylethane-1,2-diamine.
| Compound Name | 1-cyclohexyl-N-piperidin-1-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 83011945 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | 1-cyclohexyl-N-piperidin-1-ylethane-1,2-diamine |
| SMILES | NCC(NN1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C13H27N3/c14-11-13(12-7-3-1-4-8-12)15-16-9-5-2-6-10-16/h12-13,15H,1-11,14H2 |
| InChIKey | MLBAXJMOTPQAEZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |