C15H13BrN2O2S — CID 79186001
N-(4-bromo-2-methylphenyl)-4-(cyanomethyl)benzenesulfonamide (PubChem CID 79186001) has the molecular formula C15H13BrN2O2S and a molecular weight of 365.25 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-4-(cyanomethyl)benzenesulfonamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-4-(cyanomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79186001 |
| Molecular Formula | C15H13BrN2O2S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-4-(cyanomethyl)benzenesulfonamide |
| SMILES | Cc1cc(Br)ccc1NS(=O)(=O)c1ccc(CC#N)cc1 |
| InChI | InChI=1S/C15H13BrN2O2S/c1-11-10-13(16)4-7-15(11)18-21(19,20)14-5-2-12(3-6-14)8-9-17/h2-7,10,18H,8H2,1H3 |
| InChIKey | UTTFYJVDAGSJBK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |