C13H8F3N3O — CID 79194735
3-(furan-2-yl)-1-(3,4,5-trifluorophenyl)pyrazol-5-amine (PubChem CID 79194735) has the molecular formula C13H8F3N3O and a molecular weight of 279.22 g/mol. Its IUPAC name is 3-(furan-2-yl)-1-(3,4,5-trifluorophenyl)pyrazol-5-amine.
| Compound Name | 3-(furan-2-yl)-1-(3,4,5-trifluorophenyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 79194735 |
| Molecular Formula | C13H8F3N3O |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 3-(furan-2-yl)-1-(3,4,5-trifluorophenyl)pyrazol-5-amine |
| SMILES | Nc1cc(-c2ccco2)nn1-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H8F3N3O/c14-8-4-7(5-9(15)13(8)16)19-12(17)6-10(18-19)11-2-1-3-20-11/h1-6H,17H2 |
| InChIKey | GPNFRBBJIRWKNF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|