About N-cyano-N'-(4-methylphenyl)oxamide
N-cyano-N'-(4-methylphenyl)oxamide (PubChem CID 79195305) has the molecular formula C10H9N3O2
and a molecular weight of 203.20 g/mol. Its IUPAC name is N-cyano-N'-(4-methylphenyl)oxamide.
Molecular Properties
| Compound Name | N-cyano-N'-(4-methylphenyl)oxamide |
| PubChem CID | 79195305 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | N-cyano-N'-(4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NC#N)cc1 |
| InChI | InChI=1S/C10H9N3O2/c1-7-2-4-8(5-3-7)13-10(15)9(14)12-6-11/h2-5H,1H3,(H,12,14)(H,13,15) |
| InChIKey | SJDPPNNXWGNMDG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze N-cyano-N'-(4-methylphenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyano-N'-(4-methylphenyl)oxamide?
The IUPAC name of N-cyano-N'-(4-methylphenyl)oxamide (CID 79195305) is N-cyano-N'-(4-methylphenyl)oxamide.
What is the SMILES notation for N-cyano-N'-(4-methylphenyl)oxamide?
The canonical SMILES for N-cyano-N'-(4-methylphenyl)oxamide is Cc1ccc(NC(=O)C(=O)NC#N)cc1.
What is the InChIKey of N-cyano-N'-(4-methylphenyl)oxamide?
The InChIKey is SJDPPNNXWGNMDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2/c1-7-2-4-8(5-3-7)13-10(15)9(14)12-6-11/h2-5H,1H3,(H,12,14)(H,13,15).
What are the key properties of N-cyano-N'-(4-methylphenyl)oxamide?
N-cyano-N'-(4-methylphenyl)oxamide has a molecular weight of 203.20 g/mol, XLogP of 0.53, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyano-N'-(4-methylphenyl)oxamide is sourced from PubChem (CID 79195305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).