C10H20F3NO — CID 79198505
N-ethyl-6,6,6-trifluoro-2-methoxy-2-methylhexan-3-amine (PubChem CID 79198505) has the molecular formula C10H20F3NO and a molecular weight of 227.27 g/mol. Its IUPAC name is N-ethyl-6,6,6-trifluoro-2-methoxy-2-methylhexan-3-amine.
| Compound Name | N-ethyl-6,6,6-trifluoro-2-methoxy-2-methylhexan-3-amine |
|---|---|
| PubChem CID | 79198505 |
| Molecular Formula | C10H20F3NO |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | N-ethyl-6,6,6-trifluoro-2-methoxy-2-methylhexan-3-amine |
| SMILES | CCNC(CCC(F)(F)F)C(C)(C)OC |
| InChI | InChI=1S/C10H20F3NO/c1-5-14-8(9(2,3)15-4)6-7-10(11,12)13/h8,14H,5-7H2,1-4H3 |
| InChIKey | MXWUTBXYHQZRRR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |