3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid

C16H13BrO3S — CID 79206798

IUPAC3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid
SMILESO=C(O)c1cccc(Br)c1OCC1CSc2ccccc21
InChIInChI=1S/C16H13BrO3S/c17-13-6-3-5-12(16(18)19)15(13)20-8-10-9-21-14-7-2-1-4-11(10)14/h1-7,10H,8-9H2,(H,18,19)
InChIKeyXTUSOIPHRIZIHS-UHFFFAOYSA-N
MW365.25 g/mol
LogP4.42
Rot. Bonds4

About 3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid

3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid (PubChem CID 79206798) has the molecular formula C16H13BrO3S and a molecular weight of 365.25 g/mol. Its IUPAC name is 3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid.

Molecular Properties

Compound Name3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid
PubChem CID79206798
Molecular FormulaC16H13BrO3S
Molecular Weight365.25 g/mol
Exact Mass363.98
IUPAC Name3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid
SMILESO=C(O)c1cccc(Br)c1OCC1CSc2ccccc21
InChIInChI=1S/C16H13BrO3S/c17-13-6-3-5-12(16(18)19)15(13)20-8-10-9-21-14-7-2-1-4-11(10)14/h1-7,10H,8-9H2,(H,18,19)
InChIKeyXTUSOIPHRIZIHS-UHFFFAOYSA-N
XLogP4.42
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500365.25
LogP ≤ 54.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid?
The IUPAC name of 3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid (CID 79206798) is 3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid.
What is the SMILES notation for 3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid?
The canonical SMILES for 3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid is O=C(O)c1cccc(Br)c1OCC1CSc2ccccc21.
What is the InChIKey of 3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid?
The InChIKey is XTUSOIPHRIZIHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13BrO3S/c17-13-6-3-5-12(16(18)19)15(13)20-8-10-9-21-14-7-2-1-4-11(10)14/h1-7,10H,8-9H2,(H,18,19).
What are the key properties of 3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid?
3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid has a molecular weight of 365.25 g/mol, XLogP of 4.42, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid is sourced from PubChem (CID 79206798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).