C16H13BrO3S — CID 79206798
3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid (PubChem CID 79206798) has the molecular formula C16H13BrO3S and a molecular weight of 365.25 g/mol. Its IUPAC name is 3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid.
| Compound Name | 3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 79206798 |
| Molecular Formula | C16H13BrO3S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | 3-bromo-2-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzoic acid |
| SMILES | O=C(O)c1cccc(Br)c1OCC1CSc2ccccc21 |
| InChI | InChI=1S/C16H13BrO3S/c17-13-6-3-5-12(16(18)19)15(13)20-8-10-9-21-14-7-2-1-4-11(10)14/h1-7,10H,8-9H2,(H,18,19) |
| InChIKey | XTUSOIPHRIZIHS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |