C14H18N2O4 — CID 79209013
4-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoylamino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 79209013) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoylamino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoylamino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79209013 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoylamino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | Cc1noc(C)c1CCC(=O)NC1C=CC(C(=O)O)C1 |
| InChI | InChI=1S/C14H18N2O4/c1-8-12(9(2)20-16-8)5-6-13(17)15-11-4-3-10(7-11)14(18)19/h3-4,10-11H,5-7H2,1-2H3,(H,15,17)(H,18,19) |
| InChIKey | YCXJRXRBXSJFKZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|