C15H19N3O2 — CID 79210320
4-[[(4-aminocyclopent-2-ene-1-carbonyl)-methylamino]methyl]benzamide (PubChem CID 79210320) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-[[(4-aminocyclopent-2-ene-1-carbonyl)-methylamino]methyl]benzamide.
| Compound Name | 4-[[(4-aminocyclopent-2-ene-1-carbonyl)-methylamino]methyl]benzamide |
|---|---|
| PubChem CID | 79210320 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 4-[[(4-aminocyclopent-2-ene-1-carbonyl)-methylamino]methyl]benzamide |
| SMILES | CN(Cc1ccc(C(N)=O)cc1)C(=O)C1C=CC(N)C1 |
| InChI | InChI=1S/C15H19N3O2/c1-18(15(20)12-6-7-13(16)8-12)9-10-2-4-11(5-3-10)14(17)19/h2-7,12-13H,8-9,16H2,1H3,(H2,17,19) |
| InChIKey | BWMKBSRGQHIJED-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|