C13H22N4O2 — CID 79210332
2-[4-(4-aminocyclopent-2-ene-1-carbonyl)-1,4-diazepan-1-yl]acetamide (PubChem CID 79210332) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[4-(4-aminocyclopent-2-ene-1-carbonyl)-1,4-diazepan-1-yl]acetamide.
| Compound Name | 2-[4-(4-aminocyclopent-2-ene-1-carbonyl)-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 79210332 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-[4-(4-aminocyclopent-2-ene-1-carbonyl)-1,4-diazepan-1-yl]acetamide |
| SMILES | NC(=O)CN1CCCN(C(=O)C2C=CC(N)C2)CC1 |
| InChI | InChI=1S/C13H22N4O2/c14-11-3-2-10(8-11)13(19)17-5-1-4-16(6-7-17)9-12(15)18/h2-3,10-11H,1,4-9,14H2,(H2,15,18) |
| InChIKey | ZLYVBELVJBWVNT-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|