C14H19N3S — CID 79212455
N-amino-N'-cyclopentyl-2,3-dihydro-1-benzothiophene-3-carboximidamide (PubChem CID 79212455) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is N-amino-N'-cyclopentyl-2,3-dihydro-1-benzothiophene-3-carboximidamide.
| Compound Name | N-amino-N'-cyclopentyl-2,3-dihydro-1-benzothiophene-3-carboximidamide |
|---|---|
| PubChem CID | 79212455 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-amino-N'-cyclopentyl-2,3-dihydro-1-benzothiophene-3-carboximidamide |
| SMILES | NN/C(=N\C1CCCC1)C1CSc2ccccc21 |
| InChI | InChI=1S/C14H19N3S/c15-17-14(16-10-5-1-2-6-10)12-9-18-13-8-4-3-7-11(12)13/h3-4,7-8,10,12H,1-2,5-6,9,15H2,(H,16,17) |
| InChIKey | TTWGTUHTTXYSHI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|