C18H22ClNS — CID 79213464
N-[2-(4-chlorophenyl)-1-(2-methylsulfanylphenyl)ethyl]propan-1-amine (PubChem CID 79213464) has the molecular formula C18H22ClNS and a molecular weight of 319.90 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-1-(2-methylsulfanylphenyl)ethyl]propan-1-amine.
| Compound Name | N-[2-(4-chlorophenyl)-1-(2-methylsulfanylphenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 79213464 |
| Molecular Formula | C18H22ClNS |
| Molecular Weight | 319.90 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-[2-(4-chlorophenyl)-1-(2-methylsulfanylphenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(Cl)cc1)c1ccccc1SC |
| InChI | InChI=1S/C18H22ClNS/c1-3-12-20-17(13-14-8-10-15(19)11-9-14)16-6-4-5-7-18(16)21-2/h4-11,17,20H,3,12-13H2,1-2H3 |
| InChIKey | RIJWCEGBENWOKB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.90 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |