C10H17N3O5S — CID 79215980
4-(3-sulfamoylpropylcarbamoylamino)cyclopent-2-ene-1-carboxylic acid (PubChem CID 79215980) has the molecular formula C10H17N3O5S and a molecular weight of 291.33 g/mol. Its IUPAC name is 4-(3-sulfamoylpropylcarbamoylamino)cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-(3-sulfamoylpropylcarbamoylamino)cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79215980 |
| Molecular Formula | C10H17N3O5S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 4-(3-sulfamoylpropylcarbamoylamino)cyclopent-2-ene-1-carboxylic acid |
| SMILES | NS(=O)(=O)CCCNC(=O)NC1C=CC(C(=O)O)C1 |
| InChI | InChI=1S/C10H17N3O5S/c11-19(17,18)5-1-4-12-10(16)13-8-3-2-7(6-8)9(14)15/h2-3,7-8H,1,4-6H2,(H,14,15)(H2,11,17,18)(H2,12,13,16) |
| InChIKey | KXQBMMWFNHHDRN-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|