C17H21NOS — CID 79217018
2-(3-methoxyphenyl)-N-methyl-1-(2-methylsulfanylphenyl)ethanamine (PubChem CID 79217018) has the molecular formula C17H21NOS and a molecular weight of 287.43 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-N-methyl-1-(2-methylsulfanylphenyl)ethanamine.
| Compound Name | 2-(3-methoxyphenyl)-N-methyl-1-(2-methylsulfanylphenyl)ethanamine |
|---|---|
| PubChem CID | 79217018 |
| Molecular Formula | C17H21NOS |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-(3-methoxyphenyl)-N-methyl-1-(2-methylsulfanylphenyl)ethanamine |
| SMILES | CNC(Cc1cccc(OC)c1)c1ccccc1SC |
| InChI | InChI=1S/C17H21NOS/c1-18-16(15-9-4-5-10-17(15)20-3)12-13-7-6-8-14(11-13)19-2/h4-11,16,18H,12H2,1-3H3 |
| InChIKey | QRKKOMYHWDYPEL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |