C16H16ClF2NO — CID 82772035
1-(4-chloro-2,5-difluorophenyl)-2-(3-methoxyphenyl)-N-methylethanamine (PubChem CID 82772035) has the molecular formula C16H16ClF2NO and a molecular weight of 311.76 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-2-(3-methoxyphenyl)-N-methylethanamine.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-2-(3-methoxyphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 82772035 |
| Molecular Formula | C16H16ClF2NO |
| Molecular Weight | 311.76 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-2-(3-methoxyphenyl)-N-methylethanamine |
| SMILES | CNC(Cc1cccc(OC)c1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C16H16ClF2NO/c1-20-16(7-10-4-3-5-11(6-10)21-2)12-8-15(19)13(17)9-14(12)18/h3-6,8-9,16,20H,7H2,1-2H3 |
| InChIKey | CNWODMJGPOYUCC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.76 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|