C13H13N3O — CID 7921930
N-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]pyridine-2-carboxamide (PubChem CID 7921930) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is N-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]pyridine-2-carboxamide.
| Compound Name | N-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 7921930 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]pyridine-2-carboxamide |
| SMILES | O=C(N/N=C1/C[C@H]2C=CC[C@@H]12)c1ccccn1 |
| InChI | InChI=1S/C13H13N3O/c17-13(11-6-1-2-7-14-11)16-15-12-8-9-4-3-5-10(9)12/h1-4,6-7,9-10H,5,8H2,(H,16,17)/b15-12-/t9-,10-/m1/s1 |
| InChIKey | VIAAVXSMJUXRTG-HDNPNFOBSA-N |
| XLogP | 1.76 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|