C16H19N3O2 — CID 768050
N-[[(1R,3S)-5-hydroxy-2-adamantylidene]amino]pyridine-2-carboxamide (PubChem CID 768050) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is N-[[(1R,3S)-5-hydroxy-2-adamantylidene]amino]pyridine-2-carboxamide.
| Compound Name | N-[[(1R,3S)-5-hydroxy-2-adamantylidene]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 768050 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-[[(1R,3S)-5-hydroxy-2-adamantylidene]amino]pyridine-2-carboxamide |
| SMILES | O=C(N/N=C1\[C@@H]2CC3C[C@H]1CC(O)(C3)C2)c1ccccn1 |
| InChI | InChI=1S/C16H19N3O2/c20-15(13-3-1-2-4-17-13)19-18-14-11-5-10-6-12(14)9-16(21,7-10)8-11/h1-4,10-12,21H,5-9H2,(H,19,20)/b18-14-/t10?,11-,12+,16?/m0/s1 |
| InChIKey | MPNGZQRYAILHPO-KQXKIDJSSA-N |
| XLogP | 1.74 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|