C19H17ClN2O2S — CID 7922039
(5R,10bS)-9-chloro-2-thiophen-2-ylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,3'-cyclohexane]-1'-one (PubChem CID 7922039) has the molecular formula C19H17ClN2O2S and a molecular weight of 372.88 g/mol. Its IUPAC name is (5R,10bS)-9-chloro-2-thiophen-2-ylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,3'-cyclohexane]-1'-one.
| Compound Name | (5R,10bS)-9-chloro-2-thiophen-2-ylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,3'-cyclohexane]-1'-one |
|---|---|
| PubChem CID | 7922039 |
| Molecular Formula | C19H17ClN2O2S |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | (5R,10bS)-9-chloro-2-thiophen-2-ylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,3'-cyclohexane]-1'-one |
| SMILES | O=C1CCC[C@]2(C1)Oc1ccc(Cl)cc1[C@@H]1CC(c3cccs3)=NN12 |
| InChI | InChI=1S/C19H17ClN2O2S/c20-12-5-6-17-14(9-12)16-10-15(18-4-2-8-25-18)21-22(16)19(24-17)7-1-3-13(23)11-19/h2,4-6,8-9,16H,1,3,7,10-11H2/t16-,19+/m0/s1 |
| InChIKey | REKNSJNSRGFBLS-QFBILLFUSA-N |
| XLogP | 4.78 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |