C19H21ClO — CID 79220400
3-[2-(chloromethyl)-3-(4-methylphenyl)propyl]-2,3-dihydro-1-benzofuran (PubChem CID 79220400) has the molecular formula C19H21ClO and a molecular weight of 300.83 g/mol. Its IUPAC name is 3-[2-(chloromethyl)-3-(4-methylphenyl)propyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 3-[2-(chloromethyl)-3-(4-methylphenyl)propyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 79220400 |
| Molecular Formula | C19H21ClO |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 3-[2-(chloromethyl)-3-(4-methylphenyl)propyl]-2,3-dihydro-1-benzofuran |
| SMILES | Cc1ccc(CC(CCl)CC2COc3ccccc32)cc1 |
| InChI | InChI=1S/C19H21ClO/c1-14-6-8-15(9-7-14)10-16(12-20)11-17-13-21-19-5-3-2-4-18(17)19/h2-9,16-17H,10-13H2,1H3 |
| InChIKey | ZQEXFDPIACKUBQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|