C13H16O3 — CID 81008483
4-(2,3-dihydro-1-benzofuran-3-yl)-3-methylbutanoic acid (PubChem CID 81008483) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzofuran-3-yl)-3-methylbutanoic acid.
| Compound Name | 4-(2,3-dihydro-1-benzofuran-3-yl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 81008483 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 4-(2,3-dihydro-1-benzofuran-3-yl)-3-methylbutanoic acid |
| SMILES | CC(CC(=O)O)CC1COc2ccccc21 |
| InChI | InChI=1S/C13H16O3/c1-9(7-13(14)15)6-10-8-16-12-5-3-2-4-11(10)12/h2-5,9-10H,6-8H2,1H3,(H,14,15) |
| InChIKey | YFAMXXPCLXBCOY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |