C14H20N2S2 — CID 79222195
3-[2,3-dihydro-1-benzothiophen-2-ylmethyl(methyl)amino]-2-methylpropanethioamide (PubChem CID 79222195) has the molecular formula C14H20N2S2 and a molecular weight of 280.46 g/mol. Its IUPAC name is 3-[2,3-dihydro-1-benzothiophen-2-ylmethyl(methyl)amino]-2-methylpropanethioamide.
| Compound Name | 3-[2,3-dihydro-1-benzothiophen-2-ylmethyl(methyl)amino]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 79222195 |
| Molecular Formula | C14H20N2S2 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 3-[2,3-dihydro-1-benzothiophen-2-ylmethyl(methyl)amino]-2-methylpropanethioamide |
| SMILES | CC(CN(C)CC1Cc2ccccc2S1)C(N)=S |
| InChI | InChI=1S/C14H20N2S2/c1-10(14(15)17)8-16(2)9-12-7-11-5-3-4-6-13(11)18-12/h3-6,10,12H,7-9H2,1-2H3,(H2,15,17) |
| InChIKey | KEOOACGBIMLNPH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|