C17H18ClNO — CID 79229682
2-(1-chloroethyl)-N-(2,3-dihydro-1-benzofuran-3-ylmethyl)aniline (PubChem CID 79229682) has the molecular formula C17H18ClNO and a molecular weight of 287.79 g/mol. Its IUPAC name is 2-(1-chloroethyl)-N-(2,3-dihydro-1-benzofuran-3-ylmethyl)aniline.
| Compound Name | 2-(1-chloroethyl)-N-(2,3-dihydro-1-benzofuran-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 79229682 |
| Molecular Formula | C17H18ClNO |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-(1-chloroethyl)-N-(2,3-dihydro-1-benzofuran-3-ylmethyl)aniline |
| SMILES | CC(Cl)c1ccccc1NCC1COc2ccccc21 |
| InChI | InChI=1S/C17H18ClNO/c1-12(18)14-6-2-4-8-16(14)19-10-13-11-20-17-9-5-3-7-15(13)17/h2-9,12-13,19H,10-11H2,1H3 |
| InChIKey | IWKDHBFBLALWSY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|