C15H14INO — CID 79226500
N-(2,3-dihydro-1-benzofuran-3-ylmethyl)-2-iodoaniline (PubChem CID 79226500) has the molecular formula C15H14INO and a molecular weight of 351.19 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-3-ylmethyl)-2-iodoaniline.
| Compound Name | N-(2,3-dihydro-1-benzofuran-3-ylmethyl)-2-iodoaniline |
|---|---|
| PubChem CID | 79226500 |
| Molecular Formula | C15H14INO |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-3-ylmethyl)-2-iodoaniline |
| SMILES | Ic1ccccc1NCC1COc2ccccc21 |
| InChI | InChI=1S/C15H14INO/c16-13-6-2-3-7-14(13)17-9-11-10-18-15-8-4-1-5-12(11)15/h1-8,11,17H,9-10H2 |
| InChIKey | XGVKKMHIDCMGNO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|