C15H12Cl2FNO — CID 107573888
3,5-dichloro-N-(2,3-dihydro-1-benzofuran-3-ylmethyl)-4-fluoroaniline (PubChem CID 107573888) has the molecular formula C15H12Cl2FNO and a molecular weight of 312.17 g/mol. Its IUPAC name is 3,5-dichloro-N-(2,3-dihydro-1-benzofuran-3-ylmethyl)-4-fluoroaniline.
| Compound Name | 3,5-dichloro-N-(2,3-dihydro-1-benzofuran-3-ylmethyl)-4-fluoroaniline |
|---|---|
| PubChem CID | 107573888 |
| Molecular Formula | C15H12Cl2FNO |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 3,5-dichloro-N-(2,3-dihydro-1-benzofuran-3-ylmethyl)-4-fluoroaniline |
| SMILES | Fc1c(Cl)cc(NCC2COc3ccccc32)cc1Cl |
| InChI | InChI=1S/C15H12Cl2FNO/c16-12-5-10(6-13(17)15(12)18)19-7-9-8-20-14-4-2-1-3-11(9)14/h1-6,9,19H,7-8H2 |
| InChIKey | WUJXSGFTYMWWTK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|