C14H16O2 — CID 79229773
3-(2,3-dihydro-1-benzofuran-3-ylmethyl)cyclopent-2-en-1-ol (PubChem CID 79229773) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-3-ylmethyl)cyclopent-2-en-1-ol.
| Compound Name | 3-(2,3-dihydro-1-benzofuran-3-ylmethyl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 79229773 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-3-ylmethyl)cyclopent-2-en-1-ol |
| SMILES | OC1C=C(CC2COc3ccccc32)CC1 |
| InChI | InChI=1S/C14H16O2/c15-12-6-5-10(8-12)7-11-9-16-14-4-2-1-3-13(11)14/h1-4,8,11-12,15H,5-7,9H2 |
| InChIKey | FFSKXUJXJQWZPH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|