C15H13FO3S — CID 79230016
3-[(2-fluorophenyl)sulfonylmethyl]-2,3-dihydro-1-benzofuran (PubChem CID 79230016) has the molecular formula C15H13FO3S and a molecular weight of 292.33 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)sulfonylmethyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 3-[(2-fluorophenyl)sulfonylmethyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 79230016 |
| Molecular Formula | C15H13FO3S |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 3-[(2-fluorophenyl)sulfonylmethyl]-2,3-dihydro-1-benzofuran |
| SMILES | O=S(=O)(CC1COc2ccccc21)c1ccccc1F |
| InChI | InChI=1S/C15H13FO3S/c16-13-6-2-4-8-15(13)20(17,18)10-11-9-19-14-7-3-1-5-12(11)14/h1-8,11H,9-10H2 |
| InChIKey | NBPWZUPTZDIHJL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |