C13H22N4 — CID 79230691
6-[(4-ethyl-3-methylpiperazin-1-yl)methyl]pyridin-2-amine (PubChem CID 79230691) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is 6-[(4-ethyl-3-methylpiperazin-1-yl)methyl]pyridin-2-amine.
| Compound Name | 6-[(4-ethyl-3-methylpiperazin-1-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 79230691 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 6-[(4-ethyl-3-methylpiperazin-1-yl)methyl]pyridin-2-amine |
| SMILES | CCN1CCN(Cc2cccc(N)n2)CC1C |
| InChI | InChI=1S/C13H22N4/c1-3-17-8-7-16(9-11(17)2)10-12-5-4-6-13(14)15-12/h4-6,11H,3,7-10H2,1-2H3,(H2,14,15) |
| InChIKey | AXLKERXONWWUMW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |