C13H18N4O — CID 82862697
2-[(6-amino-2-pyridinyl)methyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one (PubChem CID 82862697) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-[(6-amino-2-pyridinyl)methyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one.
| Compound Name | 2-[(6-amino-2-pyridinyl)methyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 82862697 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-[(6-amino-2-pyridinyl)methyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
| SMILES | Nc1cccc(CN2CCN3C(=O)CCC3C2)n1 |
| InChI | InChI=1S/C13H18N4O/c14-12-3-1-2-10(15-12)8-16-6-7-17-11(9-16)4-5-13(17)18/h1-3,11H,4-9H2,(H2,14,15) |
| InChIKey | UQDBXEZESAENLL-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |