C13H19N5 — CID 79231213
N-methyl-6-[[methyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]pyridin-2-amine (PubChem CID 79231213) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is N-methyl-6-[[methyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]pyridin-2-amine.
| Compound Name | N-methyl-6-[[methyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 79231213 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | N-methyl-6-[[methyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]pyridin-2-amine |
| SMILES | CNc1cccc(CN(C)Cc2nccn2C)n1 |
| InChI | InChI=1S/C13H19N5/c1-14-12-6-4-5-11(16-12)9-17(2)10-13-15-7-8-18(13)3/h4-8H,9-10H2,1-3H3,(H,14,16) |
| InChIKey | TUEGYXYUMRXVBY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |