C15H12N2O2S — CID 79240203
quinolin-4-ylmethyl 3-aminothiophene-2-carboxylate (PubChem CID 79240203) has the molecular formula C15H12N2O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is quinolin-4-ylmethyl 3-aminothiophene-2-carboxylate.
| Compound Name | quinolin-4-ylmethyl 3-aminothiophene-2-carboxylate |
|---|---|
| PubChem CID | 79240203 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | quinolin-4-ylmethyl 3-aminothiophene-2-carboxylate |
| SMILES | Nc1ccsc1C(=O)OCc1ccnc2ccccc12 |
| InChI | InChI=1S/C15H12N2O2S/c16-12-6-8-20-14(12)15(18)19-9-10-5-7-17-13-4-2-1-3-11(10)13/h1-8H,9,16H2 |
| InChIKey | CAZHYCZFXHXYTF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |