About quinolin-4-ylmethyl N'-aminocarbamimidothioate
quinolin-4-ylmethyl N'-aminocarbamimidothioate (PubChem CID 79240810) has the molecular formula C11H12N4S
and a molecular weight of 232.31 g/mol. Its IUPAC name is quinolin-4-ylmethyl N'-aminocarbamimidothioate.
Molecular Properties
| Compound Name | quinolin-4-ylmethyl N'-aminocarbamimidothioate |
| PubChem CID | 79240810 |
| Molecular Formula | C11H12N4S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | quinolin-4-ylmethyl N'-aminocarbamimidothioate |
| SMILES | NN=C(N)SCc1ccnc2ccccc12 |
| InChI | InChI=1S/C11H12N4S/c12-11(15-13)16-7-8-5-6-14-10-4-2-1-3-9(8)10/h1-6H,7,13H2,(H2,12,15) |
| InChIKey | ICFPLIOPHVRINJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze quinolin-4-ylmethyl N'-aminocarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-4-ylmethyl N'-aminocarbamimidothioate?
The IUPAC name of quinolin-4-ylmethyl N'-aminocarbamimidothioate (CID 79240810) is quinolin-4-ylmethyl N'-aminocarbamimidothioate.
What is the SMILES notation for quinolin-4-ylmethyl N'-aminocarbamimidothioate?
The canonical SMILES for quinolin-4-ylmethyl N'-aminocarbamimidothioate is NN=C(N)SCc1ccnc2ccccc12.
What is the InChIKey of quinolin-4-ylmethyl N'-aminocarbamimidothioate?
The InChIKey is ICFPLIOPHVRINJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4S/c12-11(15-13)16-7-8-5-6-14-10-4-2-1-3-9(8)10/h1-6H,7,13H2,(H2,12,15).
What are the key properties of quinolin-4-ylmethyl N'-aminocarbamimidothioate?
quinolin-4-ylmethyl N'-aminocarbamimidothioate has a molecular weight of 232.31 g/mol, XLogP of 1.66, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-4-ylmethyl N'-aminocarbamimidothioate is sourced from PubChem (CID 79240810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).