C13H21N3O4 — CID 79241741
6-[(3,5-dimethyl-1,2-oxazol-4-yl)methylcarbamoylamino]hexanoic acid (PubChem CID 79241741) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is 6-[(3,5-dimethyl-1,2-oxazol-4-yl)methylcarbamoylamino]hexanoic acid.
| Compound Name | 6-[(3,5-dimethyl-1,2-oxazol-4-yl)methylcarbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 79241741 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 6-[(3,5-dimethyl-1,2-oxazol-4-yl)methylcarbamoylamino]hexanoic acid |
| SMILES | Cc1noc(C)c1CNC(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C13H21N3O4/c1-9-11(10(2)20-16-9)8-15-13(19)14-7-5-3-4-6-12(17)18/h3-8H2,1-2H3,(H,17,18)(H2,14,15,19) |
| InChIKey | RMPPHCPANJXHPF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|