C14H15BrN4S — CID 79242602
6-bromo-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1H-benzimidazole-2-thione (PubChem CID 79242602) has the molecular formula C14H15BrN4S and a molecular weight of 351.27 g/mol. Its IUPAC name is 6-bromo-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1H-benzimidazole-2-thione.
| Compound Name | 6-bromo-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 79242602 |
| Molecular Formula | C14H15BrN4S |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 6-bromo-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1H-benzimidazole-2-thione |
| SMILES | Cc1nn(C)c(C)c1Cn1c(=S)[nH]c2cc(Br)ccc21 |
| InChI | InChI=1S/C14H15BrN4S/c1-8-11(9(2)18(3)17-8)7-19-13-5-4-10(15)6-12(13)16-14(19)20/h4-6H,7H2,1-3H3,(H,16,20) |
| InChIKey | YWDPIBXSQVYQIW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|