C14H20ClNO — CID 79242882
2-chloro-6-[(3,4-dimethylcyclohexyl)oxymethyl]pyridine (PubChem CID 79242882) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is 2-chloro-6-[(3,4-dimethylcyclohexyl)oxymethyl]pyridine.
| Compound Name | 2-chloro-6-[(3,4-dimethylcyclohexyl)oxymethyl]pyridine |
|---|---|
| PubChem CID | 79242882 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-chloro-6-[(3,4-dimethylcyclohexyl)oxymethyl]pyridine |
| SMILES | CC1CCC(OCc2cccc(Cl)n2)CC1C |
| InChI | InChI=1S/C14H20ClNO/c1-10-6-7-13(8-11(10)2)17-9-12-4-3-5-14(15)16-12/h3-5,10-11,13H,6-9H2,1-2H3 |
| InChIKey | RETMTLCQLFKIGJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|