C22H24N2OS — CID 7924768
(3S)-3-phenyl-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]butanamide (PubChem CID 7924768) has the molecular formula C22H24N2OS and a molecular weight of 364.51 g/mol. Its IUPAC name is (3S)-3-phenyl-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | (3S)-3-phenyl-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 7924768 |
| Molecular Formula | C22H24N2OS |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (3S)-3-phenyl-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]butanamide |
| SMILES | Cc1cc(C)c(-c2csc(NC(=O)C[C@H](C)c3ccccc3)n2)cc1C |
| InChI | InChI=1S/C22H24N2OS/c1-14-10-17(4)19(11-15(14)2)20-13-26-22(23-20)24-21(25)12-16(3)18-8-6-5-7-9-18/h5-11,13,16H,12H2,1-4H3,(H,23,24,25)/t16-/m0/s1 |
| InChIKey | YKVMBFKMCRAASW-INIZCTEOSA-N |
| XLogP | 5.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |