C12H24N4O — CID 79248049
(2S)-2-[(4-amino-1-methyl-3-propan-2-ylpyrazol-5-yl)amino]-3-methylbutan-1-ol (PubChem CID 79248049) has the molecular formula C12H24N4O and a molecular weight of 240.35 g/mol. Its IUPAC name is (2S)-2-[(4-amino-1-methyl-3-propan-2-ylpyrazol-5-yl)amino]-3-methylbutan-1-ol.
| Compound Name | (2S)-2-[(4-amino-1-methyl-3-propan-2-ylpyrazol-5-yl)amino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 79248049 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | (2S)-2-[(4-amino-1-methyl-3-propan-2-ylpyrazol-5-yl)amino]-3-methylbutan-1-ol |
| SMILES | CC(C)c1nn(C)c(N[C@H](CO)C(C)C)c1N |
| InChI | InChI=1S/C12H24N4O/c1-7(2)9(6-17)14-12-10(13)11(8(3)4)15-16(12)5/h7-9,14,17H,6,13H2,1-5H3/t9-/m1/s1 |
| InChIKey | HRRNCYJURPQDOB-SECBINFHSA-N |
| XLogP | 1.55 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |