C11H17NO3 — CID 79252738
N-(1-hydroxy-3-methylbutan-2-yl)-3-methylfuran-2-carboxamide (PubChem CID 79252738) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is N-(1-hydroxy-3-methylbutan-2-yl)-3-methylfuran-2-carboxamide.
| Compound Name | N-(1-hydroxy-3-methylbutan-2-yl)-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 79252738 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | N-(1-hydroxy-3-methylbutan-2-yl)-3-methylfuran-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)NC(CO)C(C)C |
| InChI | InChI=1S/C11H17NO3/c1-7(2)9(6-13)12-11(14)10-8(3)4-5-15-10/h4-5,7,9,13H,6H2,1-3H3,(H,12,14) |
| InChIKey | MKSJYFYQOXZOHN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |