C13H20ClN3 — CID 79254918
2-[1-[(4-chloro-2-pyridinyl)methyl]piperidin-4-yl]ethanamine (PubChem CID 79254918) has the molecular formula C13H20ClN3 and a molecular weight of 253.78 g/mol. Its IUPAC name is 2-[1-[(4-chloro-2-pyridinyl)methyl]piperidin-4-yl]ethanamine.
| Compound Name | 2-[1-[(4-chloro-2-pyridinyl)methyl]piperidin-4-yl]ethanamine |
|---|---|
| PubChem CID | 79254918 |
| Molecular Formula | C13H20ClN3 |
| Molecular Weight | 253.78 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-[1-[(4-chloro-2-pyridinyl)methyl]piperidin-4-yl]ethanamine |
| SMILES | NCCC1CCN(Cc2cc(Cl)ccn2)CC1 |
| InChI | InChI=1S/C13H20ClN3/c14-12-2-6-16-13(9-12)10-17-7-3-11(1-5-15)4-8-17/h2,6,9,11H,1,3-5,7-8,10,15H2 |
| InChIKey | GJFOXWBVRBNGPQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.78 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |