C15H22ClN3 — CID 79256003
1-[(4-chloro-2-pyridinyl)methyl]-4-cyclopentylpiperazine (PubChem CID 79256003) has the molecular formula C15H22ClN3 and a molecular weight of 279.81 g/mol. Its IUPAC name is 1-[(4-chloro-2-pyridinyl)methyl]-4-cyclopentylpiperazine.
| Compound Name | 1-[(4-chloro-2-pyridinyl)methyl]-4-cyclopentylpiperazine |
|---|---|
| PubChem CID | 79256003 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 1-[(4-chloro-2-pyridinyl)methyl]-4-cyclopentylpiperazine |
| SMILES | Clc1ccnc(CN2CCN(C3CCCC3)CC2)c1 |
| InChI | InChI=1S/C15H22ClN3/c16-13-5-6-17-14(11-13)12-18-7-9-19(10-8-18)15-3-1-2-4-15/h5-6,11,15H,1-4,7-10,12H2 |
| InChIKey | FMZGGCFDBALGCF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |