C12H15N3OS — CID 79259758
[2-(2-thiophen-2-ylethoxymethyl)-4-pyridinyl]hydrazine (PubChem CID 79259758) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is [2-(2-thiophen-2-ylethoxymethyl)-4-pyridinyl]hydrazine.
| Compound Name | [2-(2-thiophen-2-ylethoxymethyl)-4-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 79259758 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | [2-(2-thiophen-2-ylethoxymethyl)-4-pyridinyl]hydrazine |
| SMILES | NNc1ccnc(COCCc2cccs2)c1 |
| InChI | InChI=1S/C12H15N3OS/c13-15-10-3-5-14-11(8-10)9-16-6-4-12-2-1-7-17-12/h1-3,5,7-8H,4,6,9,13H2,(H,14,15) |
| InChIKey | ZHBHEMUTCCUVBU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|